Home
Products
Peimisine
| Product Name | Peimisine |
| Price: | $117 / 10mg |
| Catalog No.: | CN02077 |
| CAS No.: | 19773-24-1 |
| Molecular Formula: | C27H41NO3 |
| Molecular Weight: | 427.62 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The bulbs of Fritillaria cirrhosa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CC[C@]2([C@H](C1)C(=O)C[C@@H]1[C@@H]2CC2=C(C)[C@]3(CC[C@@H]12)O[C@H]1[C@H]([C@H]3C)NC[C@H](C1)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Peimisine(Ebeiensine) is a steroidal alkaloid which is the major biologically active component in Bulbus Fritillariae; possess a variety of toxicological and pharmacological effects on humans. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 573.0±50.0 °C at 760 mmHg |
| Flash Point | 300.3±30.1 °C |
| Exact Mass | 427.308655 |
| PSA | 58.56000 |
| LogP | 3.70 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |
| Storage condition | -20°C |