Home
Products
8-Oxycoptisine
| Product Name | 8-Oxycoptisine |
| Price: | $219 / 10mg |
| Catalog No.: | CN01265 |
| CAS No.: | 19716-61-1 |
| Molecular Formula: | C19H13NO5 |
| Molecular Weight: | 335.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Hypecoum erectum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1c2c(ccc3c2OCO3)cc2n1CCc1c2cc2c(c1)OCO2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 8-Oxocoptisine is a natural protoberberine alkaloid with anti-cancer activity[1]. |
| In Vitro | 8-Oxocoptisine has cytotoxicity against NCI-N87 (IC50=20.31 μM) and has no cytotoxicity against Caco-2 (IC50>100 μM)[1]. |
| Density | 1.6±0.0 g/cm3 |
| Boiling Point | 617.5±0.0 °C at 760 mmHg |
| Flash Point | 327.3±0.0 °C |
| Exact Mass | 335.079010 |
| LogP | 4.65 |
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |
| Storage condition | 2-8℃ |