Home
Products
Oxyepiberberine
| Product Name | Oxyepiberberine |
| Price: | $219 / 10mg |
| Catalog No.: | CN01051 |
| CAS No.: | 19716-60-0 |
| Molecular Formula: | C20H17NO5 |
| Molecular Weight: | 351.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Coptis chinensis Franch. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2c(cc1OC)CCn1c2cc2ccc3c(c2c1=O)OCO3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 8-Oxoepiberberine is an alkaloid metabolite in the plasma after oral administration of Zuojin formula, a traditional chinese medicine used to treat gastrointestinal disease[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 603.3±55.0 °C at 760 mmHg |
| Flash Point | 318.7±31.5 °C |
| Exact Mass | 351.110687 |
| LogP | 3.87 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Storage condition | 2-8℃ |