Home
Products
Stigmasterol glucoside
| Product Name | Stigmasterol glucoside |
| Price: | $409 / 5mg |
| Catalog No.: | CN02568 |
| CAS No.: | 19716-26-8 |
| Molecular Formula: | C35H58O6 |
| Molecular Weight: | 574.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The herbs of Perilla frutescens (L.) Britt. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CCC(C(C)C)C=CC(C1CCC2C1(C)CCC1C2CC=C2C1(C)CCC(C2)OC1OC(CO)C(C(C1O)O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Stigmasterol glucoside is a sterol isolated from P. urinaria with high antioxidant and anti-inflammatory activities[1], act as an inhibitor of 5α-reductase with an IC50 of 27.2 µM[2]. |
| Target | IC50：27.2 µM (5α-reductase)[2] |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 673.6±55.0 °C at 760 mmHg |
| Flash Point | 361.2±31.5 °C |
| Exact Mass | 574.423340 |
| PSA | 99.38000 |
| LogP | 8.26 |
| Vapour Pressure | 0.0±4.7 mmHg at 25°C |
| Storage condition | 2-8°C |