Home
Products
10-Methoxycamptothecin
| Product Name | 10-Methoxycamptothecin |
| Price: | $293 / 10mg |
| Catalog No.: | CN01417 |
| CAS No.: | 19685-10-0 |
| Molecular Formula: | C21H18N2O5 |
| Molecular Weight: | 378.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Cryst. |
| Source: | The barks of Camptotheca acuminata Decne |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC[C@@]1(O)C(=O)OCc2c1cc1c3nc4ccc(cc4cc3Cn1c2=O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 10-Methoxycamptothecin is a natural bioactive derivative of camptothecin (CPT) isolated from Camptotheca acuminata, and has been confirmed to possess high anti-cancer properties. 10-Methoxycamptothecin has higher cytotoxicity than 10-hydroxycamptothecin by testing antitumor activity against 2774 cell lines[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 773.1±60.0 °C at 760 mmHg |
| Flash Point | 421.4±32.9 °C |
| Exact Mass | 378.121582 |
| PSA | 90.65000 |
| LogP | 1.69 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Storage condition | 2-8C |