Home
Products
25R-Inokosterone
| Product Name | 25R-Inokosterone |
| Price: | $409 / 5mg |
| Catalog No.: | CN02410 |
| CAS No.: | 19682-38-3 |
| Molecular Formula: | C27H44O7 |
| Molecular Weight: | 480.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The roots of Achyranthes bidentata Blume. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@@H](CC[C@H]([C@@]([C@H]1CC[C@@]2([C@]1(C)CC[C@H]1C2=CC(=O)[C@H]2[C@]1(C)C[C@H](O)[C@@H](C2)O)O)(O)C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 25R-Inokosterone is a phytoecdysone isolated from Achyranthis Radix[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 713.2±60.0 °C at 760 mmHg |
| Flash Point | 399.1±29.4 °C |
| Exact Mass | 480.308716 |
| PSA | 138.45000 |
| LogP | -0.46 |
| Vapour Pressure | 0.0±5.2 mmHg at 25°C |