Home
Products
Murrayone
| Product Name | Murrayone |
| Price: | $204 / 5mg |
| Catalog No.: | CN06269 |
| CAS No.: | 19668-69-0 |
| Molecular Formula: | C15H14O4 |
| Molecular Weight: | 258.27 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The leaves of Murraya koenigii |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1CC(=O)C(=C)C)oc(=O)cc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Murrayone, a coumarin-containing compound extracted from M. paniculata, is the most bioactive substance in this species and is a cancer metastasis chemopreventive agent based on its unique pharmacological properties[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 452.8±45.0 °C at 760 mmHg |
| Flash Point | 203.4±28.8 °C |
| Exact Mass | 258.089203 |
| PSA | 56.51000 |
| LogP | 1.93 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |