Home
Products
25S-Inokosterone
| Product Name | 25S-Inokosterone |
| Price: | $409 / 5mg |
| Catalog No.: | CN02411 |
| CAS No.: | 19595-18-7 |
| Molecular Formula: | C27H44O7 |
| Molecular Weight: | 480.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The roots of Achyranthes bidentata Blume. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@H](CC[C@H]([C@@]([C@H]1CC[C@@]2([C@]1(C)CC[C@H]1C2=CC(=O)[C@H]2[C@]1(C)C[C@H](O)[C@@H](C2)O)O)(O)C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 25S-Inokosterone is a phytoecdysone in the roots of two same species of A. bidentata Blume and A. japonica Nakai, and two different species of C. capitata Moq and C. officinalis Kuan. 25S-Inokosterone has the potential for the LPS-induced acute kidney injury research[1][2]. |
| In Vitro | 25S-Inokosterone (10 μM) significantly promotes the proliferation of LPS-induced NRK52e cells (1.0 μg/mL LPS). 25S-Inokosterone significantly reduces the rate of NRK52e cells apoptosis[1]. 25S-Inokosterone shows weak inhibitory activity for thymus and activation-regulated chemokine expression levels in TNF-α plus IFN-γ induced HaCaT cells. 25S-Inokosterone exhibits the most potent inhibition (80-95% at 200 µg/mL) against TNF-α expression levels in A23187 plus phorbol-myrisrate acetate-induced RBL-2H3 cells[3]. |
| Exact Mass | 480.30900 |
| PSA | 138.45000 |
| LogP | 1.71150 |