Home
Products
2-O-Acetyl-20-hydroxyecdysone
| Product Name | 2-O-Acetyl-20-hydroxyecdysone |
| Price: | $234 / 10mg |
| Catalog No.: | CN02307 |
| CAS No.: | 19536-25-5 |
| Molecular Formula: | C29H46O8 |
| Molecular Weight: | 522.67 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The roots of Cyanotis arachnoidea C. B. Clarke. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@H]1C[C@@]2(C)[C@@H](C[C@H]1O)C(=O)C=C1[C@@H]2CC[C@]2([C@@]1(O)CC[C@@H]2[C@]([C@@H](CCC(O)(C)C)O)(O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2-O-Acetyl-20-hydroxyecdysone, an ecdysterones in insects and terrestrial plants, inhibits amyloid-β42 (Aβ42)-induced cytotoxicity. 2-O-Acetyl-20-hydroxyecdysone could decrease Aβ oligomer formation through promotion of fibrogenesis, transforming Aβ oligomers to the low-toxicity fibrils[1]. |
| Density | 1.26±0.1 g/cm3 |
| Boiling Point | 707.3±60.0 °C |
| Exact Mass | 522.319 |
| PSA | 144.52 |
| LogP | 2.4248 |