Home
Products
Galantamine hydrobromide
| Product Name | Galantamine hydrobromide |
| Price: | Inquiry |
| Catalog No.: | CN01069 |
| CAS No.: | 1953-04-4 |
| Molecular Formula: | C17H22BrNO3 |
| Molecular Weight: | 368.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The bulbs of Lycoris radiata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c3c1O[C@@H]1[C@@]3(CCN(C2)C)C=C[C@@H](C1)O.Br |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Galanthamine hydrobromide is a long-acting, centrally active acetylcholinesterase(AChE) inhibitor (IC50 = 410 nM) and allosteric potentiator at neuronal nicotinic ACh receptors. IC50 Value: 410 nM Target: AChEGalanthamine hydrobromide prevents β-amyloid-induced apoptosis in SH-SY5Y and bovine chromaffin cells. Long-term administration reduces amyloid precursor protein deposition and neurodegeneration in a mouse model of Alzheimer's disease. |
| Exact Mass | 367.078308 |
| PSA | 41.93000 |
| LogP | 2.74630 |
| Vapour Pressure | 0mmHg at 25°C |
| Storage condition | −20°C |