Home
Products
Melittoside
| Product Name | Melittoside |
| Price: | $219 / 20mg |
| Catalog No.: | CN03035 |
| CAS No.: | 19467-03-9 |
| Molecular Formula: | C21H32O15 |
| Molecular Weight: | 524.47 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rehmannia glutinosa |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C[C@@]3([C@H]2C(=C[C@H]3O)CO)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Melittoside is a natural compound. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 890.0±65.0 °C at 760 mmHg |
| Flash Point | 492.1±34.3 °C |
| Exact Mass | 524.174133 |
| LogP | -5.40 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8℃ |