Home
Products
Curcumenol
| Product Name | Curcumenol |
| Price: | $86 / 10mg |
| Catalog No.: | CN09318 |
| CAS No.: | 19431-84-6 |
| Molecular Formula: | C15H22O2 |
| Molecular Weight: | 234.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Curcuma zedoaria |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=C1C[C@]23O[C@]1(O)C=C([C@@H]3CC[C@@H]2C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Curcumenol is one of constituents in the plants of medicinally important genus of Curcuma[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 349.3±42.0 °C at 760 mmHg |
| Flash Point | 146.7±22.1 °C |
| Exact Mass | 234.161987 |
| PSA | 29.46000 |
| LogP | 3.40 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Storage condition | 2-8°C |