Home
Products
Dihydrocapsaicin
| Product Name | Dihydrocapsaicin |
| Price: | $34 / 20mg |
| Catalog No.: | CN02137 |
| CAS No.: | 19408-84-5 |
| Molecular Formula: | C18H29NO3 |
| Molecular Weight: | 307.43 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | White cryst. |
| Source: | The fruits of Capsicum annuum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(CNC(=O)CCCCCCC(C)C)ccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dihydrocapsaicin is a natural capsaicin, acts as a selective TRPV1 agonist, and also increases p-Akt levels. Dihydrocapsaicin enhances the hypothermia-induced neuroprotection[1][2]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 457.3±55.0 °C at 760 mmHg |
| Flash Point | 230.4±31.5 °C |
| Exact Mass | 307.214752 |
| PSA | 58.56000 |
| LogP | 4.72 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | 2-8°C |