Home
Products
GB 1b
| Product Name | GB 1b |
| Price: | Inquiry |
| Catalog No.: | CN04666 |
| CAS No.: | 19360-72-6 |
| Molecular Formula: | C30H22O10 |
| Molecular Weight: | 542.49 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Garcinia travancorica. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)[C@@H]1CC(=O)c2c(O1)c(c(cc2O)O)[C@@H]1[C@H](Oc2c(C1=O)c(O)cc(c2)O)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Exact Mass | 542.12100 |
| PSA | 173.98000 |
| LogP | 4.72690 |