Home
Products
3-Isomangostin
| Product Name | 3-Isomangostin |
| Price: | $204 / 5mg |
| Catalog No.: | CN05843 |
| CAS No.: | 19275-46-8 |
| Molecular Formula: | C24H26O6 |
| Molecular Weight: | 410.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Yellow powder |
| Source: | The fruits of Garcinia mangostana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(O)cc2c(c1CC=C(C)C)c(=O)c1c(o2)cc2c(c1O)CCC(O2)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-Isomangostin, extracted from Garciniamangostana.L. shell, is a potent MutT homologue 1 (MTH1) inhibitor with an IC50 value of 52 nM. 3-isomangostin would be an attractive chemical tool for the development of anticancer agents[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 615.9±55.0 °C at 760 mmHg |
| Flash Point | 212.3±25.0 °C |
| Exact Mass | 410.172943 |
| PSA | 89.13000 |
| LogP | 5.72 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |