Home
Products
1-Isomangostin
| Product Name | 1-Isomangostin |
| Price: | Inquiry |
| Catalog No.: | CN05719 |
| CAS No.: | 19275-44-6 |
| Molecular Formula: | C24H26O6 |
| Molecular Weight: | 410.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Powder |
| Source: | The fruits of Garcinia mangostana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(O)cc2c(c1CC=C(C)C)c(=O)c1c(o2)cc(c2c1OC(C)(C)CC2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.257g/cm3 |
| Boiling Point | 613.9ºC at 760mmHg |
| Flash Point | 211.5ºC |
| Exact Mass | 410.17300 |
| PSA | 89.13000 |
| LogP | 4.97830 |
| Vapour Pressure | 1.16E-15mmHg at 25°C |