Home
Products
Harpagoside
| Product Name | Harpagoside |
| Price: | $77 / 20mg |
| Catalog No.: | CN03161 |
| CAS No.: | 19210-12-9 |
| Molecular Formula: | C24H30O11 |
| Molecular Weight: | 494.49 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The roots of Scrophularia ningpoensis Hemsl. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C[C@@]3([C@H]2[C@@](C)(OC(=O)/C=C/c2ccccc2)C[C@H]3O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Harpagoside is isolated from Harpagophytum procumbens (Hp). Harpagoside has inhibitory effects on COX-1 and COX-2 activity and inhibits NO production[1]. |
| Target | COX-1 COX-2 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 720.7±60.0 °C at 760 mmHg |
| Flash Point | 244.3±26.4 °C |
| Exact Mass | 494.178802 |
| PSA | 175.37000 |
| LogP | -0.92 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Storage condition | 2-8°C |