Home
Products
Hinokiflavone
| Product Name | Hinokiflavone |
| Price: | Inquiry |
| Catalog No.: | CN05148 |
| CAS No.: | 19202-36-9 |
| Molecular Formula: | C30H18O10 |
| Molecular Weight: | 538.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The leaves of Platycladus orientalis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)c1cc(=O)c2c(o1)cc(c(c2O)Oc1ccc(cc1)c1cc(=O)c2c(o1)cc(cc2O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hinokiflavone is a novel modulator of pre-mRNA splicing activity in vitro and in cellulo. Hinokiflavone blocks splicing of pre-mRNA substrates by inhibiting spliceosome assembly, specifically preventing B complex formation. Hinokiflavone is a SUMO protease inhibitor, inhibiting sentrin-specific protease 1 (SENP1) activity[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 841.5±65.0 °C at 760 mmHg |
| Flash Point | 284.8±27.8 °C |
| Exact Mass | 538.090027 |
| PSA | 170.80000 |
| LogP | 4.33 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Storage condition | 2-8℃ |