Home
Products
Tenacissoside H
| Product Name | Tenacissoside H |
| Price: | $92 / 20mg |
| Catalog No.: | CN02467 |
| CAS No.: | 191729-45-0 |
| Molecular Formula: | C42H66O14 |
| Molecular Weight: | 794.97 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The herbs of Marsdenia tenacissima |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CCC(C(=O)O[C@@H]1[C@@H](OC(=O)C)[C@]2(C)[C@@H](CC[C@@]32[C@]2([C@H]1[C@@]1(C)CC[C@@H](C[C@@H]1CC2)O[C@H]1C[C@@H](OC)[C@@H]([C@H](O1)C)O[C@@H]1O[C@H](C)[C@H]([C@H]([C@H]1O)OC)O)O3)C(=O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tenacissoside H is a Chinese medicine monomer extracted, isolated from Caulis Marsdeniae Tenacissimae.IC50 value:Target:In vitro: TDH significantly inhibited cells proliferation in a time-and-dose-dependent manner. TDH arrested the cell cycle in S phase and significantly inhibited PI3K and NF-κB mRNA expression, compared with blank controlled group (P < 0.05). [1]In vivo: TDH strongly inhibits tumor growth and volume. PCNA expression was significantly decreased after treatment of TDH. TDH downregulated proteins expression in PI3K/Akt-NF-κB transduction cascade (P < 0.05). [1] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 815.4±65.0 °C at 760 mmHg |
| Flash Point | 235.5±27.8 °C |
| Exact Mass | 794.445251 |
| PSA | 178.04000 |
| LogP | 4.73 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |