Home
Products
Tenacissoside G
| Product Name | Tenacissoside G |
| Price: | $176 / 20mg |
| Catalog No.: | CN02469 |
| CAS No.: | 191729-43-8 |
| Molecular Formula: | C42H64O14 |
| Molecular Weight: | 792.96 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The herbs of Marsdenia tenacissima |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COC1CC(OC2CCC3(C(C2)CCC24C3C(OC(=O)C(=CC)C)C(OC(=O)C)C3(C4(O2)CCC3C(=O)C)C)C)OC(C1OC1OC(C)C(C(C1O)OC)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tenacissoside G is a C21 steroid from the stems of Marsdenia tenacissima. Tenacissoside G reverses multidrug resistance in P-glycoprotein (Pgp)-overexpressing multidrug-resistant cancer cells[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 821.8±65.0 °C at 760 mmHg |
| Flash Point | 238.4±27.8 °C |
| Exact Mass | 792.429626 |
| PSA | 178.04000 |
| LogP | 5.01 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8C |