Home
Products
Trimethylgallic acid methyl ester
| Product Name | Trimethylgallic acid methyl ester |
| Price: | $15 / 20mg |
| Catalog No.: | CN03879 |
| CAS No.: | 1916-07-0 |
| Molecular Formula: | C11H14O5 |
| Molecular Weight: | 226.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The stems of Pterolobium hexapetallum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)c1cc(OC)c(c(c1)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Methyl 3,4,5-trimethoxybenzoate can be synthesized from Gallic acid. Methyl 3,4,5-trimethoxybenzoate is mainly used in the production of Trimethoprim (TMP), Sulfa synergistic intermediates, and many other agents. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 274.5±0.0 °C at 760 mmHg |
| Flash Point | 115.2±18.2 °C |
| Exact Mass | 226.084122 |
| PSA | 53.99000 |
| LogP | 1.74 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |