Home
Products
Epieriocalyxin A
| Product Name | Epieriocalyxin A |
| Price: | Inquiry |
| Catalog No.: | CN08883 |
| CAS No.: | 191545-24-1 |
| Molecular Formula: | C20H24O5 |
| Molecular Weight: | 344.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Isodon eriocalyx |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=CC1C(C)(C)C=CC(=O)C21COC(=O)C13C2CCC(C1)C(C3=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | epi-Eriocalyxin A (Epieriocalyxin A), a diterpenoid isolated from Isodon eriocalyx, induces colon cancer apoptosis. epi-Eriocalyxin A also inhibits ERK1/2 and JNK activation, which suppresses Bcl-2 expression[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 563.4±50.0 °C at 760 mmHg |
| Flash Point | 248.4±30.2 °C |
| Exact Mass | 344.162384 |
| PSA | 77.51000 |
| LogP | 1.69 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |