Home
Products
Salvigenin
| Product Name | Salvigenin |
| Price: | $204 / 5mg |
| Catalog No.: | CN05470 |
| CAS No.: | 19103-54-9 |
| Molecular Formula: | C18H16O6 |
| Molecular Weight: | 328.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Salvia japonica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1cc(=O)c2c(o1)cc(c(c2O)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Salvigenin is a natural polyphenolic compound, with neuroprotective effect. Salvigenin has antitumor cytotoxic and immunomodulatory properties[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 535.9±50.0 °C at 760 mmHg |
| Flash Point | 196.9±23.6 °C |
| Exact Mass | 328.094696 |
| PSA | 78.13000 |
| LogP | 3.01 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | 2-8℃ |