Home
Products
Gracillin
| Product Name | Gracillin |
| Price: | $80 / 20mg |
| Catalog No.: | CN02540 |
| CAS No.: | 19083-00-2 |
| Molecular Formula: | C45H72O17 |
| Molecular Weight: | 885.04 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The roots of Dioscorea opposita Thunb. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3(C(=CC[C@@H]4[C@@H]3CC[C@]3([C@H]4C[C@H]4[C@@H]3[C@H](C)[C@]3(O4)CC[C@H](CO3)C)C)C2)C)[C@@H]([C@H]([C@@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gracillin is a kind of steroidal saponin isolated from the root bark of wild yam Dioscorea nipponica with antitumor agent.Gracillin could induce cell cycle arrest, oxidative stress, and apoptosis in HL60 cells.[1] |
| Density | 1.4±0.1 g/cm3 |
| Exact Mass | 884.476929 |
| PSA | 255.91000 |
| LogP | 4.41 |
| Storage condition | -20°C |