Home
Products
Demethoxyencecalin
| Product Name | Demethoxyencecalin |
| Price: | Inquiry |
| Catalog No.: | CN04085 |
| CAS No.: | 19013-07-1 |
| Molecular Formula: | C13H14O2 |
| Molecular Weight: | 202.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Centaurea solstitialis L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)c1ccc2c(c1)C=CC(O2)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Demethoxyencecalin is a chromene isolated from Helianthus annuus, has antifungal activities[1]. |
| Target | IC50: antifungal[1] |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 329.8±42.0 °C at 760 mmHg |
| Flash Point | 147.7±21.4 °C |
| Exact Mass | 202.099380 |
| PSA | 26.30000 |
| LogP | 3.23 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |