Home
Products
Eupatoriochromene
| Product Name | Eupatoriochromene |
| Price: | $219 / 5mg |
| Catalog No.: | CN04086 |
| CAS No.: | 19013-03-7 |
| Molecular Formula: | C13H14O3 |
| Molecular Weight: | 218.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Centaurea solstitialis L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)c1cc2C=CC(Oc2cc1O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Eupatoriochromene is a chromene and has inhibitory activity against xanthine oxidase (XO)[1][2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 366.7±42.0 °C at 760 mmHg |
| Flash Point | 140.4±21.4 °C |
| Exact Mass | 218.094299 |
| PSA | 46.53000 |
| LogP | 4.15 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |