Home
Products
Pinostrobin chalcone
| Product Name | Pinostrobin chalcone |
| Price: | $409 / 10mg |
| Catalog No.: | CN05696 |
| CAS No.: | 18956-15-5 |
| Molecular Formula: | C16H14O4 |
| Molecular Weight: | 270.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Yellow powder |
| Source: | The heartwoods of Lindera umbellata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c(c(c1)O)C(=O)/C=C/c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pinostrobin chalcone is found to be potent natural cytotoxic compounds against MDA-MB-231 and HT-29 colon cancer cell lines(IC50 = 20.42±2.23 and 22.51±0.42 μg/mL)[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 521.1±50.0 °C at 760 mmHg |
| Flash Point | 198.0±23.6 °C |
| Exact Mass | 270.089203 |
| PSA | 66.76000 |
| LogP | 4.40 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |