Home
Products
Triptinin B
| Product Name | Triptinin B |
| Price: | Inquiry |
| Catalog No.: | CN08445 |
| CAS No.: | 189389-05-7 |
| Molecular Formula: | C20H26O3 |
| Molecular Weight: | 314.42 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Tripterygium wilfordii Hook.f. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)C1=C(C)C2C(CC1)(C)c1ccc(c(c1CC2)O)C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |