Home
Products
N-Caffeoyl O-methyltyramine
| Product Name | N-Caffeoyl O-methyltyramine |
| Price: | Inquiry |
| Catalog No.: | CN00609 |
| CAS No.: | 189307-47-9 |
| Molecular Formula: | C18H19NO4 |
| Molecular Weight: | 313.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Opuntia clavata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)CCNC(=O)/C=C/c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | N-Caffeoyl O-methyltyramine is a class of alkaloid isolated from Cuscuta reflexa with strong inhibitory activity against α-glucosidase (IC50 of 103.58 μM)[1]. |
| Target | IC50: 103.58 μM (α-glucosidase)[1] |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 603.4±55.0 °C at 760 mmHg |
| Flash Point | 318.7±31.5 °C |
| Exact Mass | 313.131409 |
| LogP | 2.44 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |