Home
Products
Hulupinic acid
| Product Name | Hulupinic acid |
| Price: | $366 / 10mg |
| Catalog No.: | CN06511 |
| CAS No.: | 1891-42-5 |
| Molecular Formula: | C15H20O4 |
| Molecular Weight: | 264.32 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Humulus lupulus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCC1(CC=C(C)C)C(=O)C(=C(C1=O)O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hulupinic acid is a prominent oxidation product of hop acids[1]. |
| Exact Mass | 264.13600 |
| PSA | 74.60000 |
| LogP | 3.16480 |