Home
Products
Cyanidin-3-O-rutinoside chloride
| Product Name | Cyanidin-3-O-rutinoside chloride |
| Price: | Inquiry |
| Catalog No.: | CN05106 |
| CAS No.: | 18719-76-1 |
| Molecular Formula: | C27H31O15Cl |
| Molecular Weight: | 630.98 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vaccinium myrtillus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1cc(O)c2c(c1)[o+]c(c(c2)O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)[C@H]([C@@H]([C@H]1O)O)O)c1ccc(c(c1)O)O.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Keracyanin chloride (Cyanidin 3-rutinoside chloride), an anthocyanin, has antioxidant activity. Keracyanin chloride inhibits malonaldehyde formation in oxidized calf thymus DNA[1][2]. |
| Exact Mass | 630.135132 |
| PSA | 252.36000 |
| Storage condition | −20°C |