Home
Products
Quercetin-3-O-sophoroside
| Product Name | Quercetin-3-O-sophoroside |
| Price: | $190 / 20mg |
| Catalog No.: | CN04907 |
| CAS No.: | 18609-17-1 |
| Molecular Formula: | C27H30O17 |
| Molecular Weight: | 626.51 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Hedyotis diffusa. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Quercetin 3-beta-sophoroside is isolated from the flowers of A. venetum, is an scavengers of superoxide anions[1]. |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 1037.2±65.0 °C at 760 mmHg |
| Flash Point | 341.9±27.8 °C |
| Exact Mass | 626.148315 |
| PSA | 289.66000 |
| LogP | -0.78 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |