Home
Products
Loganin
| Product Name | Loganin |
| Price: | Inquiry |
| Catalog No.: | CN03169 |
| CAS No.: | 18524-94-2 |
| Molecular Formula: | C17H26O10 |
| Molecular Weight: | 390.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Solid |
| Source: | The fruits of Cornus officinalis Sieb. et Zucc. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C([C@@H]3[C@H]2[C@@H](C)[C@H](C3)O)C(=O)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Loganin, a major iridoid glycoside obtained from Corni fructus, has been shown to have anti-inflammatory and anti-shock effects. Loganin exhibits an anti-inflammatory effect in cases of AP and its pulmonary complications through inhibition of NF-κB activation. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 608.8±55.0 °C at 760 mmHg |
| Flash Point | 217.9±25.0 °C |
| Exact Mass | 390.152588 |
| PSA | 155.14000 |
| LogP | -2.73 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |