Home
Products
Scabertopin
| Product Name | Scabertopin |
| Price: | $570 / 5mg |
| Catalog No.: | CN09352 |
| CAS No.: | 185213-52-9 |
| Molecular Formula: | C20H22O6 |
| Molecular Weight: | 358.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Elephantopus scaber Linn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C(C(=O)O[C@H]1CC2=C[C@@H](OC2=O)CC(=C[C@@H]2[C@@H]1C(=C)C(=O)O2)C)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Scabertopin, isolated from the whole plant of Elephantopus scaber[1], is a sesquiterpene lactone. Scabertopin has been found to be prominent anticancer constituents[2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 592.7±50.0 °C at 760 mmHg |
| Flash Point | 260.5±30.2 °C |
| Exact Mass | 358.141632 |
| PSA | 78.90000 |
| LogP | 2.03 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |