Home
Products
Brevifolincarboxylic acid
| Product Name | Brevifolincarboxylic acid |
| Price: | $146 / 10mg |
| Catalog No.: | CN03740 |
| CAS No.: | 18490-95-4 |
| Molecular Formula: | C13H8O8 |
| Molecular Weight: | 292.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Phyllanthus urinaria L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)C1CC(=O)c2c1c1c(O)c(O)c(cc1c(=O)o2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Brevifolincarboxylic acid is extracted from Polygonum capitatum[1], has inhibitory effect on the aryl hydrocarbon receptor (AhR)[2]. Brevifolincarboxylic acid is an α-glucosidase inhibitor with an IC50 of 323.46 μM[3]. |
| Target | IC50: 323.46 μM (α-glucosidase) (Brevifolincarboxylic acid)[3] |
| Density | 2.0±0.1 g/cm3 |
| Boiling Point | 758.5±60.0 °C at 760 mmHg |
| Flash Point | 296.2±26.4 °C |
| Exact Mass | 292.021912 |
| PSA | 145.27000 |
| LogP | 0.99 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |