Home
Products
1,3,6-Tri-O-galloylglucose
| Product Name | 1,3,6-Tri-O-galloylglucose |
| Price: | $234 / 5mg |
| Catalog No.: | CN03469 |
| CAS No.: | 18483-17-5 |
| Molecular Formula: | C27H24O18 |
| Molecular Weight: | 636.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The peels of Punica granatum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@@H]1[C@@H](COC(=O)c2cc(O)c(c(c2)O)O)O[C@H]([C@@H]([C@H]1OC(=O)c1cc(O)c(c(c1)O)O)O)OC(=O)c1cc(O)c(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 1,3,6-Tri-O-galloyl-beta-D-glucose (1,3,6-Tri-O-galloyl-β-D-glucose) is a phenolic compound in Black Walnut Kernels[1]. |
| Density | 1.98g/cm3 |
| Boiling Point | 1103.6ºC at 760mmHg |
| Flash Point | 363ºC |
| Exact Mass | 636.09600 |
| PSA | 310.66000 |
| Vapour Pressure | 0mmHg at 25°C |
| Storage condition | ?20°C |