Home
Products
Pelargonidin-3-O-glucoside chloride
| Product Name | Pelargonidin-3-O-glucoside chloride |
| Price: | $584 / 5mg |
| Catalog No.: | CN05107 |
| CAS No.: | 18466-51-8 |
| Molecular Formula: | C21H21O10Cl |
| Molecular Weight: | 468.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vaccinium myrtillus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc3c(O)cc(cc3[o+]c2c2ccc(cc2)O)O)[C@@H]([C@H]([C@@H]1O)O)O.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Callistephin (Pelargonidin 3-O-glucoside) chloride is an anthocyanin that can be found in strawberries and chokeberries[1]. |
| Exact Mass | 468.08200 |
| PSA | 173.21000 |
| Storage condition | −20°C |