Home
Products
Nuezhenidic acid
| Product Name | Nuezhenidic acid |
| Price: | $190 / 10mg |
| Catalog No.: | CN03031 |
| CAS No.: | 183238-67-7 |
| Molecular Formula: | C17H24O14 |
| Molecular Weight: | 452.36 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Ligustrum lucidum |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CCN1C[C@@H]2CC[C@@H]([C@]34C1C(C[C@H]23)[C@]12[C@H]4C[C@H]([C@H](C1)[C@H]([C@H]2O)C)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Nuezhenidic acid, isolated from the fruits of Ligustrum lucidum, posseses inhibitory activities against influenza A virus[1]. |
| Density | 1.70±0.1 g/cm3 (20 ºC 760 Torr) |