Home
Products
3,4-O-Isopropylidene shikimic acid
| Product Name | 3,4-O-Isopropylidene shikimic acid |
| Price: | $204 / 5mg |
| Catalog No.: | CN06706 |
| CAS No.: | 183075-03-8 |
| Molecular Formula: | C10H14O5 |
| Molecular Weight: | 214.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The fruits of Illicium verum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1CC(=C[C@@H]2[C@H]1OC(O2)(C)C)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3,4-O-Isopropylidene-shikimicn acid is a natural product that can be isolated from the whole plants of Hypericum wightianum. 3,4-O-Isopropylidene-shikimic acid has anti-inflammatory effect and antioxidant activities[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 404.8±45.0 °C at 760 mmHg |
| Flash Point | 162.8±22.2 °C |
| Exact Mass | 214.084122 |
| PSA | 75.99000 |
| LogP | 0.83 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |