Home
Products
Valepotriate
| Product Name | Valepotriate |
| Price: | $77 / 20mg |
| Catalog No.: | CN03121 |
| CAS No.: | 18296-44-1 |
| Molecular Formula: | C22H30NO8 |
| Molecular Weight: | 422.47 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Oil |
| Source: | The roots of Valeriana officinalis L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OCC1=CO[C@H]([C@H]2C1=C[C@@H]([C@]12OC1)OC(=O)CC(C)C)OC(=O)CC(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Valepotriate, isolated from Valeriana jatamansi Jones, has anti-epileptic and anti-cancer activities[1][2]. |
| In Vivo | Valepotriate showed significant anti-epileptic activity against MES- and PTZ-induced epilepsy at doses of 5, 10, and 20 mg/kg, and ED50 values for MES- and PTZ-induced epilepsy were 7.84 and 7.19 mg/kg, respectively. Furthermore, valepotriate (10 and 20 mg/kg) can significantly prolong sleeping time and shorten the latency time on the pentobarbital sodium-induced sleeping time test. Furthermore, valepotriate (5, 10, and 20 mg/kg) could significantly up-regulate the expression of GABAA, GAD65, and Bcl-2 and down-regulate the expression of caspase-3, but had no significant effect on the expression of GABAB[2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 525.9±50.0 °C at 760 mmHg |
| Flash Point | 226.5±30.2 °C |
| Exact Mass | 422.194061 |
| PSA | 100.66000 |
| LogP | 2.36 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |