Home
Products
Indolelactic acid
| Product Name | Indolelactic acid |
| Price: | Inquiry |
| Catalog No.: | CN00105 |
| CAS No.: | 1821-52-9 |
| Molecular Formula: | C11H11NO3 |
| Molecular Weight: | 205.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Heracleum candicans. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)C(Cc1c[nH]c2c1cccc2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Indolelactic acid is a tryptophan (Trp) catabolite in Azotobacter vinelandii cultures. |
| Target | Human Endogenous Metabolite |
| Density | 1.428g/cm3 |
| Boiling Point | 477.3ºC at 760mmHg |
| Flash Point | 242.4ºC |
| Exact Mass | 205.07400 |
| PSA | 73.32000 |
| LogP | 1.15590 |
| Storage condition | 2-8°C |