Home
Products
Thalifendine
| Product Name | Thalifendine |
| Price: | Inquiry |
| Catalog No.: | CN03296 |
| CAS No.: | 18207-71-1 |
| Molecular Formula: | C19H16NO4 |
| Molecular Weight: | 322.33 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The roots of Hydrastis canadensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(O)ccc2c1c[n+]1CCc3c(c1c2)cc1c(c3)OCO1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Exact Mass | 321.10000 |
| PSA | 49.69000 |
| LogP | 2.96190 |