Home
Products
Naringenin-4',7-diacetate
| Product Name | Naringenin-4',7-diacetate |
| Price: | Inquiry |
| Catalog No.: | CN05475 |
| CAS No.: | 18196-13-9 |
| Molecular Formula: | C19H16O7 |
| Molecular Weight: | 356.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Scutellaria baicalensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)Oc1ccc(cc1)[C@@H]1CC(=O)c2c(O1)cc(cc2O)OC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 578.9±50.0 °C at 760 mmHg |
| Flash Point | 210.5±23.6 °C |
| Exact Mass | 356.089600 |
| PSA | 99.13000 |
| LogP | 3.52 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |