Home
Products
Beta-pinene
| Product Name | Beta-pinene |
| Price: | $43 / 100mg |
| Catalog No.: | CN09635 |
| CAS No.: | 18172-67-3 |
| Molecular Formula: | C10H16 |
| Molecular Weight: | 136.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Oil |
| Source: | The heartwoods of Pinus armandii Franch |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C1CC[C@H]2C[C@@H]1C2(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | β-Pinene ((-)-β-Pinene), a major component of turpentine, inhibit infectious bronchitis virus (IBV) with an IC50 of 1.32 mM. β-Pinene presents antimicrobial activity[1][2]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 166.0±0.0 °C at 760 mmHg |
| Flash Point | 34.9±5.8 °C |
| Exact Mass | 136.125198 |
| LogP | 4.37 |
| Vapour Pressure | 2.4±0.1 mmHg at 25°C |
| Storage condition | 2~8°C |