Home
Products
Ginsenoside F4
| Product Name | Ginsenoside F4 |
| Price: | $293 / 10mg |
| Catalog No.: | CN07545 |
| CAS No.: | 181225-33-2 |
| Molecular Formula: | C42H70O12 |
| Molecular Weight: | 767.0 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Panax ginseng C. A. Mey. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2CC3(C)C(C4(C2C(C)(C)C(O)CC4)C)CC(C2C3(C)CCC2C(=CCC=C(C)C)C)O)C(C(C1O)O)OC1OC(C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ginsenoside F4 (GF4), ginseng saponinis, isolated from notoginseng or red ginseng. Ginsenoside F4 (GF4) has inhibitory effect on human lymphocytoma JK cell by inducing its apoptosis[1].Ginsenoside F4 (GF4) inhibits matrix metalloproteinase 13 (MMP 13) expression in IL-1β-treated chondrocytes and blocks cartilage breakdown in rabbit cartilage tissue culture, shows therapeutic potential for preventing cartilage collagen matrix breakdown in diseased tissues[2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 851.6±65.0 °C at 760 mmHg |
| Flash Point | 468.9±34.3 °C |
| Exact Mass | 766.486755 |
| PSA | 198.76000 |
| LogP | 8.32 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8℃ |