Home
Products
5-Hydroxy-4-methoxycanthin-6-one
| Product Name | 5-Hydroxy-4-methoxycanthin-6-one |
| Price: | $161 / 5mg |
| Catalog No.: | CN02145 |
| CAS No.: | 18110-86-6 |
| Molecular Formula: | C15H10N2O3 |
| Molecular Weight: | 266.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Yellow powder |
| Source: | The barks of Picrasma quassioides (D.Don) Benn |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(O)c(=O)n2c3c1nccc3c1c2cccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Nigakinone is one of the most abundant alkaloids responsible for the major pharmacological activities of Kumu. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 442.7±45.0 °C at 760 mmHg |
| Flash Point | 221.5±28.7 °C |
| Exact Mass | 266.069153 |
| PSA | 63.83000 |
| LogP | 1.92 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |