Home
Products
Peiminine
| Product Name | Peiminine |
| Price: | $43 / 20mg |
| Catalog No.: | CN02105 |
| CAS No.: | 18059-10-4 |
| Molecular Formula: | C27H43NO3 |
| Molecular Weight: | 429.64 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The bulbus of Fritillaria thunbergii Miq. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC1CCC2(C(C1)C(=O)CC1C2CC2C1CCC1C2CN2CC(C)CCC2C1(C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Peiminine(Verticinone; Raddeanine) is a natural compound with anti-inflammatory activity.IC50 value:Target:Peiminine and DXS significantly reduced alveolar inflammation and pulmonary interstitial inflammation in rats with bleomycin-induced lung injury. peiminine inhibits lung inflammation and pulmonary fibrosis in a rat model of bleomycin-induced lung injury, by reducing circulating IFN-γ levels and inhibiting signal transduction pathways involving TGF-β, CTGF, ERK1/2, NF-κB and FasL. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 567.1±50.0 °C at 760 mmHg |
| Flash Point | 296.8±30.1 °C |
| Exact Mass | 429.324280 |
| PSA | 60.77000 |
| LogP | 3.90 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |