Home
Products
Terrestrosin D
| Product Name | Terrestrosin D |
| Price: | $190 / 10mg |
| Catalog No.: | CN02406 |
| CAS No.: | 179464-23-4 |
| Molecular Formula: | C50H80O23 |
| Molecular Weight: | 1049.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The herbs of Tribulus terrestris L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | C#CCSc1nc(N)c2c(n1)n(cn2)C1OC(C(C1O)O)CO |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Terrestrosin D, a steroidal saponin from Tribulus terrestris L., induces cell cycle arrest and cancer cells apoptosis. Terrestrosin D has antiangiogenic activities[1]. |
| Density | 1.5±0.1 g/cm3 |
| Exact Mass | 1048.509033 |
| LogP | 0.29 |