Home
Products
Myricitrin
| Product Name | Myricitrin |
| Price: | $15 / 20mg |
| Catalog No.: | CN05476 |
| CAS No.: | 17912-87-7 |
| Molecular Formula: | C21H20O12 |
| Molecular Weight: | 464.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The root barks of Myrica cerifera L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1cc(O)c2c(c1)oc(c(c2=O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)c1cc(O)c(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Myricitrin, isolated from Daebong persimmon peel, is a major antioxidant flavonoid[1]. |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 896.6±65.0 °C at 760 mmHg |
| Flash Point | 315.7±27.8 °C |
| Exact Mass | 464.095490 |
| PSA | 210.51000 |
| LogP | 1.98 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | ?20°C |