Home
Products
Vitexin -4''-O-glucoside
| Product Name | Vitexin -4''-O-glucoside |
| Price: | $46 / 10mg |
| Catalog No.: | CN05115 |
| CAS No.: | 178468-00-3 |
| Molecular Formula: | C27H30O15 |
| Molecular Weight: | 594.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Crataegus pinnatifida Bunge |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)O)c1c(O)cc(c2c1oc(cc2=O)c1ccc(cc1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Vitexin-4''-O-glucoside is a kind of flavonoid fraction from the leaves of Crataegus pinnatifida[1]. |
| Exact Mass | 594.15800 |
| PSA | 260.20000 |
| Storage condition | -20℃ |